CAS 3152-15-6 is the registry number for 3-(4-Chlorophenyl)-2,5-furandione, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-(4-chlorophenyl)furan-2,5-dione (CAS 3152-15-6) is a chemical compound with the molecular formula C10H5ClO3 and a molecular weight of 208.60 g/mol. IUPAC name: 3-(4-chlorophenyl)furan-2,5-dione. InChIKey: BSZGHMTWYIUDFZ-UHFFFAOYSA-N.
| Molecular formula | C10H5ClO3 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 3-(4-chlorophenyl)furan-2,5-dione |
| InChIKey | BSZGHMTWYIUDFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)OC2=O)Cl |
Computed by PubChem (NCBI)