Products 15263-75-9
CAS 15263-75-9 appears in our catalog under these names: N-((4-Hydroxy-6-oxo-1,6-dihydropyrimidin-5-yl)methylene)-N-methylmethanaminium chloride, 98%, 98%, N-((4-Hydroxy-6-oxo-1,6-dihydropyrimidin-5-yl)methylene)-N-methylmethanaminium chloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)methylidene-dimethylazanium chloride (CAS 15263-75-9) is a chemical compound with the molecular formula C7H10ClN3O2 and a molecular weight of 203.62 g/mol. IUPAC name: (4-hydroxy-6-oxo-1H-pyrimidin-5-yl)methylidene-dimethylazanium chloride. InChIKey: ZOIYAEVAPVQDRB-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O2 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | (4-hydroxy-6-oxo-1H-pyrimidin-5-yl)methylidene-dimethylazanium chloride |
| InChIKey | ZOIYAEVAPVQDRB-UHFFFAOYSA-N |
| SMILES | C[N+](=CC1=C(N=CNC1=O)O)C.[Cl-] |
Computed by PubChem (NCBI)