Products 152633-90-4
CAS 152633-90-4 is the registry number for 4-(2-AMINOPHENOXY)-1,2-BENZENEDICARBONITRILE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-aminophenoxy)benzene-1,2-dicarbonitrile (CAS 152633-90-4) is a chemical compound with the molecular formula C14H9N3O and a molecular weight of 235.24 g/mol. IUPAC name: 4-(2-aminophenoxy)benzene-1,2-dicarbonitrile. InChIKey: LIBGSMDCGXNBAM-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 4-(2-aminophenoxy)benzene-1,2-dicarbonitrile |
| InChIKey | LIBGSMDCGXNBAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC2=CC(=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)