Products 1851314-58-3
CAS 1851314-58-3 is the registry number for 4-(2-BENZOFURANYL)-7H-PYRROLO[2,3-D]PYRIMIDINE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(1-benzofuran-2-yl)-7H-pyrrolo[2,3-d]pyrimidine (CAS 1851314-58-3) is a chemical compound with the molecular formula C14H9N3O and a molecular weight of 235.24 g/mol. IUPAC name: 4-(1-benzofuran-2-yl)-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: XEEBLHLKQRSBLC-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 4-(1-benzofuran-2-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | XEEBLHLKQRSBLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=C4C=CNC4=NC=N3 |
Computed by PubChem (NCBI)