CAS 248246-47-1 is the registry number for 1,11-Dihydro-2h-pyrimido[4,5-a]carbazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1,3-dihydropyrimido[4,5-a]carbazol-2-one (CAS 248246-47-1) is a chemical compound with the molecular formula C14H9N3O and a molecular weight of 235.24 g/mol. IUPAC name: 1,3-dihydropyrimido[4,5-a]carbazol-2-one. InChIKey: FDRDRYQPBCPZRX-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 1,3-dihydropyrimido[4,5-a]carbazol-2-one |
| InChIKey | FDRDRYQPBCPZRX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C=CC4=CNC(=O)NC4=C3N=C2C=C1 |
Computed by PubChem (NCBI)