CAS 15268-07-2 appears in our catalog under these names: 3,3'–Oxydianiline, 3,3'-Oxydianiline, >98.0%(GC)(T), 3,3'-Oxydianiline 95%, 3,3'-Oxydianiline, 95%, 95%, 3,3'-Oxydianiline, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g, 25g, 100g.
3-(3-aminophenoxy)aniline (CAS 15268-07-2) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 3-(3-aminophenoxy)aniline. InChIKey: LXJLFVRAWOOQDR-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 3-(3-aminophenoxy)aniline |
| InChIKey | LXJLFVRAWOOQDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=CC(=C2)N)N |
Computed by PubChem (NCBI)