CAS 1528-74-1 appears in our catalog under these names: 4,4'-Dinitrobiphenyl, 95%, 4,4'–Dinitrobiphenyl, 4,4'-Dinitrobiphenyl, >99.0%(GC), 4,4'-Dinitro-1,1'-biphenyl, 98%, 98%, 4,4'-Dinitro-1,1'-biphenyl, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 10g, 250mg.
1-nitro-4-(4-nitrophenyl)benzene (CAS 1528-74-1) is a chemical compound with the molecular formula C12H8N2O4 and a molecular weight of 244.20 g/mol. IUPAC name: 1-nitro-4-(4-nitrophenyl)benzene. InChIKey: BDLNCFCZHNKBGI-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O4 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 1-nitro-4-(4-nitrophenyl)benzene |
| InChIKey | BDLNCFCZHNKBGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)