CAS 257613-44-8 appears in our catalog under these names: (4-Oxo[1]benzofuro[3,2-d]pyrimidin-3(4h)-yl)acetic acid, 95%, 2-{6-oxo-8-oxa-3,5-diazatricyclo(7.4.0.0,2,7)trideca-1(13),2(7),3,9,11-pentaen-5-yl}acetic acid, 95%, (4-Oxo(1)benzofuro(3,2-d)pyrimidin-3(4H)-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetic acid (CAS 257613-44-8) is a chemical compound with the molecular formula C12H8N2O4 and a molecular weight of 244.20 g/mol. IUPAC name: 2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetic acid. InChIKey: CCLZWLMZZHIGPX-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O4 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetic acid |
| InChIKey | CCLZWLMZZHIGPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=O)N(C=N3)CC(=O)O |
Computed by PubChem (NCBI)