CAS 898907-67-0 appears in our catalog under these names: 5-(3-Nitrophenyl)nicotinic acid, 95%, 5-(3-Nitrophenyl)nicotinic acid, 98%, 98%, 5-(3-Nitrophenyl)-nicotinic acid, 98%(LC-MS),RG, 5-(3-Nitrophenyl)nicotinic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
5-(3-nitrophenyl)pyridine-3-carboxylic acid (CAS 898907-67-0) is a chemical compound with the molecular formula C12H8N2O4 and a molecular weight of 244.20 g/mol. IUPAC name: 5-(3-nitrophenyl)pyridine-3-carboxylic acid. InChIKey: SCCBPJUNKJQITD-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O4 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 5-(3-nitrophenyl)pyridine-3-carboxylic acid |
| InChIKey | SCCBPJUNKJQITD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)