CAS 1528461-10-0 is the registry number for 3-(2,6-Difluorophenyl)oxolane-2,5-dione, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(2,6-difluorophenyl)oxolane-2,5-dione (CAS 1528461-10-0) is a chemical compound with the molecular formula C10H6F2O3 and a molecular weight of 212.15 g/mol. IUPAC name: 3-(2,6-difluorophenyl)oxolane-2,5-dione. InChIKey: MFAVCJHHHAQSEO-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O3 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)oxolane-2,5-dione |
| InChIKey | MFAVCJHHHAQSEO-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)OC1=O)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)