CAS 1541751-49-8 appears in our catalog under these names: 2-(6,7-Difluoro-1-benzofuran-3-yl)acetic acid, 95%, 2-(6,7-Difluoro-1-benzofuran-3-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(6,7-difluoro-1-benzofuran-3-yl)acetic acid (CAS 1541751-49-8) is a chemical compound with the molecular formula C10H6F2O3 and a molecular weight of 212.15 g/mol. IUPAC name: 2-(6,7-difluoro-1-benzofuran-3-yl)acetic acid. InChIKey: XZUDFNHLYCJFQJ-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O3 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | 2-(6,7-difluoro-1-benzofuran-3-yl)acetic acid |
| InChIKey | XZUDFNHLYCJFQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=CO2)CC(=O)O)F)F |
Computed by PubChem (NCBI)