CAS 1538014-60-6 is the registry number for 2-(4,6-Difluoro-1-benzofuran-3-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4,6-difluoro-1-benzofuran-3-yl)acetic acid (CAS 1538014-60-6) is a chemical compound with the molecular formula C10H6F2O3 and a molecular weight of 212.15 g/mol. IUPAC name: 2-(4,6-difluoro-1-benzofuran-3-yl)acetic acid. InChIKey: HTVJZZLRYRMVFK-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O3 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | 2-(4,6-difluoro-1-benzofuran-3-yl)acetic acid |
| InChIKey | HTVJZZLRYRMVFK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC=C2CC(=O)O)F)F |
Computed by PubChem (NCBI)