Products 1019111-84-2

CAS 1019111-84-2 appears in our catalog under these names: 5,7-Difluoro-3-methyl-1-benzofuran-2-carboxylic acid, 98%, 5,7-Difluoro-3-methyl-1-benzofuran-2-carboxylic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 500mg, 2.5g.

5,7-difluoro-3-methyl-1-benzofuran-2-carboxylic acid (CAS 1019111-84-2) is a chemical compound with the molecular formula C10H6F2O3 and a molecular weight of 212.15 g/mol. IUPAC name: 5,7-difluoro-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: VIEBTMPYGMCTMU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6F2O3
Molecular weight212.15 g/mol
IUPAC name5,7-difluoro-3-methyl-1-benzofuran-2-carboxylic acid
InChIKeyVIEBTMPYGMCTMU-UHFFFAOYSA-N
SMILESCC1=C(OC2=C1C=C(C=C2F)F)C(=O)O

Computed by PubChem (NCBI)