CAS 152880-95-0 is the registry number for 4-((Furan-2-ylmethylene)amino)-2,4-dihydro-3H-1,2,4-triazole-3-thione, 98%, 98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
4-[(E)-furan-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione (CAS 152880-95-0) is a chemical compound with the molecular formula C7H6N4OS and a molecular weight of 194.22 g/mol. IUPAC name: 4-[(E)-furan-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione. InChIKey: HCOVGQWJYXPDFK-RUDMXATFSA-N.
| Molecular formula | C7H6N4OS |
|---|---|
| Molecular weight | 194.22 g/mol |
| IUPAC name | 4-[(E)-furan-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| InChIKey | HCOVGQWJYXPDFK-RUDMXATFSA-N |
| SMILES | C1=COC(=C1)/C=N/N2C=NNC2=S |
Computed by PubChem (NCBI)