CAS 870692-91-4 is the registry number for 4-Amino-6-(furan-2-yl)-1,3,5-triazine-2-thiol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-6-(furan-2-yl)-1H-1,3,5-triazine-4-thione (CAS 870692-91-4) is a chemical compound with the molecular formula C7H6N4OS and a molecular weight of 194.22 g/mol. IUPAC name: 2-amino-6-(furan-2-yl)-1H-1,3,5-triazine-4-thione. InChIKey: QDFDOYBRKYDLAD-UHFFFAOYSA-N.
| Molecular formula | C7H6N4OS |
|---|---|
| Molecular weight | 194.22 g/mol |
| IUPAC name | 2-amino-6-(furan-2-yl)-1H-1,3,5-triazine-4-thione |
| InChIKey | QDFDOYBRKYDLAD-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC(=S)N=C(N2)N |
Computed by PubChem (NCBI)