CAS 98550-19-7 appears in our catalog under these names: 6-(Methylthio)pyrimido[5,4-d]pyrimidin-4(3h)-one, 95%, 6-(Methylthio)pyrimido[5,4-d]pyrimidin-4(1H)-one, 95%, 6-(Methylthio)pyrimido[5,4-d]pyrimidin-4(3H)-one 98%, 6-(Methylthio)pyrimido[5,4-d]pyrimidin-4(1H)-one, 97%, 97%, 6-(Methylthio)pyrimido[5,4-d]pyrimidin-4(1H)-one, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g, 100g.
2-methylsulfanyl-7H-pyrimido[5,4-d]pyrimidin-8-one (CAS 98550-19-7) is a chemical compound with the molecular formula C7H6N4OS and a molecular weight of 194.22 g/mol. IUPAC name: 2-methylsulfanyl-7H-pyrimido[5,4-d]pyrimidin-8-one. InChIKey: AVUWNHRPNQVSOI-UHFFFAOYSA-N.
| Molecular formula | C7H6N4OS |
|---|---|
| Molecular weight | 194.22 g/mol |
| IUPAC name | 2-methylsulfanyl-7H-pyrimido[5,4-d]pyrimidin-8-one |
| InChIKey | AVUWNHRPNQVSOI-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C(=N1)C(=O)NC=N2 |
Computed by PubChem (NCBI)