CAS 15290-28-5 appears in our catalog under these names: 3-(Trimethylsilyl)benzoic acid, 95%, 3-(Trimethylsilyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-trimethylsilylbenzoic acid (CAS 15290-28-5) is a chemical compound with the molecular formula C10H14O2Si and a molecular weight of 194.30 g/mol. IUPAC name: 3-trimethylsilylbenzoic acid. InChIKey: IGKYAVPWIPSEPG-UHFFFAOYSA-N.
| Molecular formula | C10H14O2Si |
|---|---|
| Molecular weight | 194.30 g/mol |
| IUPAC name | 3-trimethylsilylbenzoic acid |
| InChIKey | IGKYAVPWIPSEPG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)