CAS 15290-29-6 appears in our catalog under these names: 4-(Trimethylsilyl)benzoic acid, 95%, 4–(Trimethylsilyl)benzoic acid, 4-(Trimethylsilyl)benzoic Acid, 4-(Trimethylsilyl)benzoic acid 97%, 4-(Trimethylsilyl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g, 50mg, 500mg, 2.5g.
4-trimethylsilylbenzoic acid (CAS 15290-29-6) is a chemical compound with the molecular formula C10H14O2Si and a molecular weight of 194.30 g/mol. IUPAC name: 4-trimethylsilylbenzoic acid. InChIKey: GKAWVRLBRQRXAG-UHFFFAOYSA-N.
| Molecular formula | C10H14O2Si |
|---|---|
| Molecular weight | 194.30 g/mol |
| IUPAC name | 4-trimethylsilylbenzoic acid |
| InChIKey | GKAWVRLBRQRXAG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)