CAS 52287-50-0 is the registry number for 1-(Trimethylsilyl)-3,4-(methylenedioxy)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-benzodioxol-5-yl(trimethyl)silane (CAS 52287-50-0) is a chemical compound with the molecular formula C10H14O2Si and a molecular weight of 194.30 g/mol. IUPAC name: 1,3-benzodioxol-5-yl(trimethyl)silane. InChIKey: STQNYNYJKVBZRM-UHFFFAOYSA-N.
| Molecular formula | C10H14O2Si |
|---|---|
| Molecular weight | 194.30 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl(trimethyl)silane |
| InChIKey | STQNYNYJKVBZRM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)