Products 1529271-70-2
CAS 1529271-70-2 is the registry number for 1-[(4-Bromo-3-fluorophenyl)methyl]piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(4-bromo-3-fluorophenyl)methyl]piperidine-4-carboxylic acid (CAS 1529271-70-2) is a chemical compound with the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. IUPAC name: 1-[(4-bromo-3-fluorophenyl)methyl]piperidine-4-carboxylic acid. InChIKey: GBTHSEDUMMXMRC-UHFFFAOYSA-N.
| Molecular formula | C13H15BrFNO2 |
|---|---|
| Molecular weight | 316.17 g/mol |
| IUPAC name | 1-[(4-bromo-3-fluorophenyl)methyl]piperidine-4-carboxylic acid |
| InChIKey | GBTHSEDUMMXMRC-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)CC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)