CAS 1936430-05-5 is the registry number for 5-Bromo-6-fluoro-2,3-dihydro-indole-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 5-bromo-6-fluoro-2,3-dihydroindole-1-carboxylate (CAS 1936430-05-5) is a chemical compound with the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. IUPAC name: tert-butyl 5-bromo-6-fluoro-2,3-dihydroindole-1-carboxylate. InChIKey: WFCXSILDZPORKG-UHFFFAOYSA-N.
| Molecular formula | C13H15BrFNO2 |
|---|---|
| Molecular weight | 316.17 g/mol |
| IUPAC name | tert-butyl 5-bromo-6-fluoro-2,3-dihydroindole-1-carboxylate |
| InChIKey | WFCXSILDZPORKG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=CC(=C(C=C21)F)Br |
Computed by PubChem (NCBI)