Products 1936430-05-5

CAS 1936430-05-5 is the registry number for 5-Bromo-6-fluoro-2,3-dihydro-indole-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-bromo-6-fluoro-2,3-dihydroindole-1-carboxylate (CAS 1936430-05-5) is a chemical compound with the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. IUPAC name: tert-butyl 5-bromo-6-fluoro-2,3-dihydroindole-1-carboxylate. InChIKey: WFCXSILDZPORKG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15BrFNO2
Molecular weight316.17 g/mol
IUPAC nametert-butyl 5-bromo-6-fluoro-2,3-dihydroindole-1-carboxylate
InChIKeyWFCXSILDZPORKG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2=CC(=C(C=C21)F)Br

Computed by PubChem (NCBI)