CAS 2134649-54-8 is the registry number for tert-Butyl 4-bromo-7-fluoroisoindoline-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-bromo-7-fluoro-1,3-dihydroisoindole-2-carboxylate (CAS 2134649-54-8) is a chemical compound with the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. IUPAC name: tert-butyl 4-bromo-7-fluoro-1,3-dihydroisoindole-2-carboxylate. InChIKey: XBEFABARELUBRK-UHFFFAOYSA-N.
| Molecular formula | C13H15BrFNO2 |
|---|---|
| Molecular weight | 316.17 g/mol |
| IUPAC name | tert-butyl 4-bromo-7-fluoro-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | XBEFABARELUBRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C=CC(=C2C1)Br)F |
Computed by PubChem (NCBI)