CAS 1530-37-6 appears in our catalog under these names: (4–Methylbenzyl)triphenylphosphonium chloride, 4-Methylbenzyl triphenylphosphonium chloride, (4-Methylbenzyl)triphenylphosphonium chloride 98+%, (4-Methylbenzyl)triphenylphosphonium chloride, 98+%, 98+%, (4-Methylbenzyl)triphenylphosphonium chloride, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 2g, 50g, 500g.
(4-methylphenyl)methyl-triphenylphosphanium chloride (CAS 1530-37-6) is a chemical compound with the molecular formula C26H24ClP and a molecular weight of 402.9 g/mol. IUPAC name: (4-methylphenyl)methyl-triphenylphosphanium chloride. InChIKey: AZHSDLYDKBEFLL-UHFFFAOYSA-M.
| Molecular formula | C26H24ClP |
|---|---|
| Molecular weight | 402.9 g/mol |
| IUPAC name | (4-methylphenyl)methyl-triphenylphosphanium chloride |
| InChIKey | AZHSDLYDKBEFLL-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)