CAS 63368-37-6 is the registry number for (3-Methylbenzyl)triphenylphosphonium chloride, 98%(HPLC),RG, 98%(HPLC),RG. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
(3-methylphenyl)methyl-triphenylphosphanium chloride (CAS 63368-37-6) is a chemical compound with the molecular formula C26H24ClP and a molecular weight of 402.9 g/mol. IUPAC name: (3-methylphenyl)methyl-triphenylphosphanium chloride. InChIKey: BNGXYYYYKUGPPF-UHFFFAOYSA-M.
| Molecular formula | C26H24ClP |
|---|---|
| Molecular weight | 402.9 g/mol |
| IUPAC name | (3-methylphenyl)methyl-triphenylphosphanium chloride |
| InChIKey | BNGXYYYYKUGPPF-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)