Products 63368-36-5

CAS 63368-36-5 appears in our catalog under these names: (2-Methylbenzyl)triphenylphosphonium chloride, 98%, (2-Methylbenzyl)triphenylphosphonium chloride, (2-Methylbenzyl)triphenylphosphonium chloride, ≥98%, ≥98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 2,5g, 0,25g, 50g.

Structural formula: {0} (CAS {1})

(2-methylphenyl)methyl-triphenylphosphanium chloride (CAS 63368-36-5) is a chemical compound with the molecular formula C26H24ClP and a molecular weight of 402.9 g/mol. IUPAC name: (2-methylphenyl)methyl-triphenylphosphanium chloride. InChIKey: RDHRQYBAQXBTNT-UHFFFAOYSA-M.

Identity
Molecular formulaC26H24ClP
Molecular weight402.9 g/mol
IUPAC name(2-methylphenyl)methyl-triphenylphosphanium chloride
InChIKeyRDHRQYBAQXBTNT-UHFFFAOYSA-M
SMILESCC1=CC=CC=C1C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]

Computed by PubChem (NCBI)