CAS 153085-12-2 is the registry number for (3E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 100mg, 1g.
(E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one (CAS 153085-12-2) is a chemical compound with the molecular formula C7H9F3O2 and a molecular weight of 182.14 g/mol. IUPAC name: (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one. InChIKey: MDSDQULKLSBZHK-SNAWJCMRSA-N.
| Molecular formula | C7H9F3O2 |
|---|---|
| Molecular weight | 182.14 g/mol |
| IUPAC name | (E)-4-ethoxy-1,1,1-trifluoro-3-methylbut-3-en-2-one |
| InChIKey | MDSDQULKLSBZHK-SNAWJCMRSA-N |
| SMILES | CCO/C=C(\C)/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)