CAS 945495-63-6 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)cyclobutane-1-carboxylic acid, 95%, 1-(2,2,2-trifluoroethyl)cyclobutane-1-carboxylic acid, 97%, 1-(2,2,2-trifluoroethyl)cyclobutane-1-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
1-(2,2,2-trifluoroethyl)cyclobutane-1-carboxylic acid (CAS 945495-63-6) is a chemical compound with the molecular formula C7H9F3O2 and a molecular weight of 182.14 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)cyclobutane-1-carboxylic acid. InChIKey: XRIDSIZKSOTJFF-UHFFFAOYSA-N.
| Molecular formula | C7H9F3O2 |
|---|---|
| Molecular weight | 182.14 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)cyclobutane-1-carboxylic acid |
| InChIKey | XRIDSIZKSOTJFF-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)