CAS 1784919-58-9 appears in our catalog under these names: 1,2,2-Trifluorocyclohexanecarboxylic acid, 95%, 1,2,2-Trifluorocyclohexanecarboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 0,5g, 50mg.
1,2,2-trifluorocyclohexane-1-carboxylic acid (CAS 1784919-58-9) is a chemical compound with the molecular formula C7H9F3O2 and a molecular weight of 182.14 g/mol. IUPAC name: 1,2,2-trifluorocyclohexane-1-carboxylic acid. InChIKey: JYFQSOQHJWRRMS-UHFFFAOYSA-N.
| Molecular formula | C7H9F3O2 |
|---|---|
| Molecular weight | 182.14 g/mol |
| IUPAC name | 1,2,2-trifluorocyclohexane-1-carboxylic acid |
| InChIKey | JYFQSOQHJWRRMS-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)(C(=O)O)F)(F)F |
Computed by PubChem (NCBI)