Products 53593-66-1
CAS 53593-66-1 is the registry number for N-Desmethyl rac-14-epi-Dextromethorphan. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
(1R,9R,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (CAS 53593-66-1) is a chemical compound with the molecular formula C17H23NO and a molecular weight of 257.37 g/mol. IUPAC name: (1R,9R,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene. InChIKey: ILNSWVUXAPSPEH-DJIMGWMZSA-N.
| Molecular formula | C17H23NO |
|---|---|
| Molecular weight | 257.37 g/mol |
| IUPAC name | (1R,9R,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| InChIKey | ILNSWVUXAPSPEH-DJIMGWMZSA-N |
| SMILES | COC1=CC2=C(C[C@@H]3[C@@H]4[C@@]2(CCCC4)CCN3)C=C1 |
Computed by PubChem (NCBI)