CAS 1532015-60-3 is the registry number for 5-Bromo-7-ethyl-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-bromo-7-ethyl-1,3-dihydroindol-2-one (CAS 1532015-60-3) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 5-bromo-7-ethyl-1,3-dihydroindol-2-one. InChIKey: NXOUVURQCMNBBB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 5-bromo-7-ethyl-1,3-dihydroindol-2-one |
| InChIKey | NXOUVURQCMNBBB-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC2=C1NC(=O)C2)Br |
Computed by PubChem (NCBI)