CAS 1532517-67-1 is the registry number for 2-Nitro-3-(2,2,2-trifluoroethoxy)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-nitro-3-(2,2,2-trifluoroethoxy)pyridine (CAS 1532517-67-1) is a chemical compound with the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. IUPAC name: 2-nitro-3-(2,2,2-trifluoroethoxy)pyridine. InChIKey: XIVQRQUKDKSBHD-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O3 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 2-nitro-3-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | XIVQRQUKDKSBHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)[N+](=O)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)