CAS 153322-13-5 is the registry number for (1R,2S)-2-(Cyclohexylamino)-1,2-diphenylethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(1R,2S)-2-(cyclohexylamino)-1,2-diphenylethanol (CAS 153322-13-5) is a chemical compound with the molecular formula C20H25NO and a molecular weight of 295.4 g/mol. IUPAC name: (1R,2S)-2-(cyclohexylamino)-1,2-diphenylethanol. InChIKey: AUJFQSIAONFRDP-VQTJNVASSA-N.
| Molecular formula | C20H25NO |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | (1R,2S)-2-(cyclohexylamino)-1,2-diphenylethanol |
| InChIKey | AUJFQSIAONFRDP-VQTJNVASSA-N |
| SMILES | C1CCC(CC1)N[C@@H](C2=CC=CC=C2)[C@@H](C3=CC=CC=C3)O |
Computed by PubChem (NCBI)