CAS 193354-70-0 appears in our catalog under these names: S1R agonist 1, 98%, S1R agonist 1, S1R agonist 1, S1R agonist 1, 95%, 95%, S1R agonist 1, 98.0%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
4-benzyl-1-(2-phenoxyethyl)piperidine (CAS 193354-70-0) is a chemical compound with the molecular formula C20H25NO and a molecular weight of 295.4 g/mol. IUPAC name: 4-benzyl-1-(2-phenoxyethyl)piperidine. InChIKey: HRBKFQYSVXXYDE-UHFFFAOYSA-N.
| Molecular formula | C20H25NO |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 4-benzyl-1-(2-phenoxyethyl)piperidine |
| InChIKey | HRBKFQYSVXXYDE-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CC2=CC=CC=C2)CCOC3=CC=CC=C3 |
Computed by PubChem (NCBI)