CAS 627836-52-6 is the registry number for 2,6,6-trimethyl-1-(4-(isopropyl)phenyl)-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
2,6,6-trimethyl-1-(4-propan-2-ylphenyl)-5,7-dihydroindol-4-one (CAS 627836-52-6) is a chemical compound with the molecular formula C20H25NO and a molecular weight of 295.4 g/mol. IUPAC name: 2,6,6-trimethyl-1-(4-propan-2-ylphenyl)-5,7-dihydroindol-4-one. InChIKey: XLMYVHVPRBSNDI-UHFFFAOYSA-N.
| Molecular formula | C20H25NO |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2,6,6-trimethyl-1-(4-propan-2-ylphenyl)-5,7-dihydroindol-4-one |
| InChIKey | XLMYVHVPRBSNDI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC=C(C=C3)C(C)C)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)