Products 1533523-21-5
CAS 1533523-21-5 is the registry number for 3-{5-Methyl-3H-imidazo(4,5-b)pyridin-2-yl}aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline (CAS 1533523-21-5) is a chemical compound with the molecular formula C13H12N4 and a molecular weight of 224.26 g/mol. IUPAC name: 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline. InChIKey: QURTZHHRUVDDGZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N4 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline |
| InChIKey | QURTZHHRUVDDGZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)NC(=N2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)