Products 1533663-34-1
CAS 1533663-34-1 appears in our catalog under these names: 3-Cyclobutyl-1,2-oxazole-5-carboxylic acid, 3-Cyclobutylisoxazole-5-carboxylic acid, 96%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-cyclobutyl-1,2-oxazole-5-carboxylic acid (CAS 1533663-34-1) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 3-cyclobutyl-1,2-oxazole-5-carboxylic acid. InChIKey: NZCUAOMMUYVSRT-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 3-cyclobutyl-1,2-oxazole-5-carboxylic acid |
| InChIKey | NZCUAOMMUYVSRT-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)