Products 153381-94-3
CAS 153381-94-3 is the registry number for Ketamine hydrochloride Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(6S)-6-amino-6-(2-chlorophenyl)cyclohex-2-en-1-one (CAS 153381-94-3) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: (6S)-6-amino-6-(2-chlorophenyl)cyclohex-2-en-1-one. InChIKey: BXBPJMHHWPXBJL-LBPRGKRZSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (6S)-6-amino-6-(2-chlorophenyl)cyclohex-2-en-1-one |
| InChIKey | BXBPJMHHWPXBJL-LBPRGKRZSA-N |
| SMILES | C1C[C@@](C(=O)C=C1)(C2=CC=CC=C2Cl)N |
Computed by PubChem (NCBI)
Synonyms:
Dehydronorketamine, (S)-, Dehydronorketamine, (+)-, Dehydronorketamine, (6S)-, 5,6-Dehydronorketamine, (+)-, 5,6-Dehydronorketamine, (6S)-, (6S)-6-Amino-6-(2-chlorophenyl)-2-cyclohexen-1-one, 2-Cyclohexen-1-one, 6-amino-6-(2-chlorophenyl)-, (S)-, 2-Cyclohexen-1-one, 6-amino-6-(2-chlorophenyl)-, (6S)-, Ketamine Hydrochloride Impurity 5, (S)-1-amino-2'-chloro-5,6-dihydro-[1,1'-biphenyl]-2(1H)-one