CAS 137090-44-9 appears in our catalog under these names: 4-(Chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole, 95%, 4–(Chloromethyl)–5–Methyl–2–(4–Methylphenyl)–1,3–Oxazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
4-(chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole (CAS 137090-44-9) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: 4-(chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole. InChIKey: DQTOUJFUSUPWOK-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 4-(chloromethyl)-5-methyl-2-(4-methylphenyl)-1,3-oxazole |
| InChIKey | DQTOUJFUSUPWOK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=C(O2)C)CCl |
Computed by PubChem (NCBI)