Products 521266-92-2
CAS 521266-92-2 appears in our catalog under these names: 4-(Chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole, 90%, 4-(Chloromethyl)-5-methyl-2-(m-tolyl)oxazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
4-(chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole (CAS 521266-92-2) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: 4-(chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole. InChIKey: CZFJTOSWONKWDN-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 4-(chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole |
| InChIKey | CZFJTOSWONKWDN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC(=C(O2)C)CCl |
Computed by PubChem (NCBI)