CAS 153433-80-8 appears in our catalog under these names: Paclitaxel Side Chain Impurity, Paclitaxel Impurity 20, (2R,3S)-N-Benzoyl-3-phenyl Isoserine Ethyl Ester, >95% (HPLC), (2R,3S)-N-Benzoyl-3-phenyl isoserine ethyl ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
Ethyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate (CAS 153433-80-8) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: ethyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate. InChIKey: OQAQLARGRIIKCB-JKSUJKDBSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | ethyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate |
| InChIKey | OQAQLARGRIIKCB-JKSUJKDBSA-N |
| SMILES | CCOC(=O)[C@@H]([C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)