CAS 153437-65-1 is the registry number for 3-(6,7-Dimethoxyquinazolin-4-ylamino)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-[(6,7-dimethoxyquinazolin-4-yl)amino]benzonitrile (CAS 153437-65-1) is a chemical compound with the molecular formula C17H14N4O2 and a molecular weight of 306.32 g/mol. IUPAC name: 3-[(6,7-dimethoxyquinazolin-4-yl)amino]benzonitrile. InChIKey: DTUCHVRTWHBOKV-UHFFFAOYSA-N.
| Molecular formula | C17H14N4O2 |
|---|---|
| Molecular weight | 306.32 g/mol |
| IUPAC name | 3-[(6,7-dimethoxyquinazolin-4-yl)amino]benzonitrile |
| InChIKey | DTUCHVRTWHBOKV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#N)OC |
Computed by PubChem (NCBI)