CAS 2554975-45-8 is the registry number for Olanzapine Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethyl-5-methyl-2-(2-nitroanilino)benzene-1,3-dicarbonitrile (CAS 2554975-45-8) is a chemical compound with the molecular formula C17H14N4O2 and a molecular weight of 306.32 g/mol. IUPAC name: 4-ethyl-5-methyl-2-(2-nitroanilino)benzene-1,3-dicarbonitrile. InChIKey: RKGLOARJEDCUJS-UHFFFAOYSA-N.
| Molecular formula | C17H14N4O2 |
|---|---|
| Molecular weight | 306.32 g/mol |
| IUPAC name | 4-ethyl-5-methyl-2-(2-nitroanilino)benzene-1,3-dicarbonitrile |
| InChIKey | RKGLOARJEDCUJS-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1C)C#N)NC2=CC=CC=C2[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)