CAS 909861-31-0 appears in our catalog under these names: 1-(1H-Benzimidazol-2-yl)-3-(4-methoxyphenyl)-1h-pyrazol-5-ol, 95%, 1-(1H-Benzo[d]imidazol-2-yl)-3-(4-methoxyphenyl)-1H-pyrazol-5-ol 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(1H-benzimidazol-2-yl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one (CAS 909861-31-0) is a chemical compound with the molecular formula C17H14N4O2 and a molecular weight of 306.32 g/mol. IUPAC name: 2-(1H-benzimidazol-2-yl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one. InChIKey: JFKKBFIRBQCLPC-UHFFFAOYSA-N.
| Molecular formula | C17H14N4O2 |
|---|---|
| Molecular weight | 306.32 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-yl)-5-(4-methoxyphenyl)-1H-pyrazol-3-one |
| InChIKey | JFKKBFIRBQCLPC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)N(N2)C3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)