CAS 1534474-93-5 appears in our catalog under these names: 2-(2-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-amine, 95%, 2-(2-Fluorophenyl)-(1,2,4)triazolo(1,5-a)pyridin-6-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-(2-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-amine (CAS 1534474-93-5) is a chemical compound with the molecular formula C12H9FN4 and a molecular weight of 228.22 g/mol. IUPAC name: 2-(2-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-amine. InChIKey: OVQDXLXLHVMGQE-UHFFFAOYSA-N.
| Molecular formula | C12H9FN4 |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| InChIKey | OVQDXLXLHVMGQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN3C=C(C=CC3=N2)N)F |
Computed by PubChem (NCBI)