Products 2924558-68-7
CAS 2924558-68-7 is the registry number for 5-(4-FLUORO-1H-INDAZOL-5-YL)PYRIDIN-2-AMINE, 98%, 98%. Offered by: Chemat. Available pack sizes: 25mg, 50mg.
5-(4-fluoro-1H-indazol-5-yl)pyridin-2-amine (CAS 2924558-68-7) is a chemical compound with the molecular formula C12H9FN4 and a molecular weight of 228.22 g/mol. IUPAC name: 5-(4-fluoro-1H-indazol-5-yl)pyridin-2-amine. InChIKey: GGCXSCYNKARQLW-UHFFFAOYSA-N.
| Molecular formula | C12H9FN4 |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 5-(4-fluoro-1H-indazol-5-yl)pyridin-2-amine |
| InChIKey | GGCXSCYNKARQLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=C(C3=C(C=C2)NN=C3)F)N |
Computed by PubChem (NCBI)