CAS 2044270-00-8 is the registry number for 4,4'-(2-Fluoro-1,4-phenylene)bis(1H-pyrazole), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole (CAS 2044270-00-8) is a chemical compound with the molecular formula C12H9FN4 and a molecular weight of 228.22 g/mol. IUPAC name: 4-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole. InChIKey: QDSHITMPSQCOGT-UHFFFAOYSA-N.
| Molecular formula | C12H9FN4 |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 4-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole |
| InChIKey | QDSHITMPSQCOGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CNN=C2)F)C3=CNN=C3 |
Computed by PubChem (NCBI)