CAS 293737-98-1 is the registry number for 2-(4-Fluorophenyl)-2H-benzo(d)(1,2,3)triazol-5-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4-fluorophenyl)benzotriazol-5-amine (CAS 293737-98-1) is a chemical compound with the molecular formula C12H9FN4 and a molecular weight of 228.22 g/mol. IUPAC name: 2-(4-fluorophenyl)benzotriazol-5-amine. InChIKey: YJHJTROQFRJDDB-UHFFFAOYSA-N.
| Molecular formula | C12H9FN4 |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 2-(4-fluorophenyl)benzotriazol-5-amine |
| InChIKey | YJHJTROQFRJDDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2N=C3C=CC(=CC3=N2)N)F |
Computed by PubChem (NCBI)