Products 153465-36-2

CAS 153465-36-2 is the registry number for Maltol Related Compound 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethyl-3-hydroxy-1-(4-hydroxybutyl)pyridin-4-one (CAS 153465-36-2) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: 2-ethyl-3-hydroxy-1-(4-hydroxybutyl)pyridin-4-one. InChIKey: PGAVJEVPRWLSBG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO3
Molecular weight211.26 g/mol
IUPAC name2-ethyl-3-hydroxy-1-(4-hydroxybutyl)pyridin-4-one
InChIKeyPGAVJEVPRWLSBG-UHFFFAOYSA-N
SMILESCCC1=C(C(=O)C=CN1CCCCO)O

Computed by PubChem (NCBI)