Products 153489-15-7

CAS 153489-15-7 is the registry number for Mandelic Acid-13C6. Offered by: TRC. Available pack sizes: 5mg.

Structural formula: {0} (CAS {1})

2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-hydroxyacetic acid (CAS 153489-15-7) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 158.10 g/mol. IUPAC name: 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-hydroxyacetic acid. InChIKey: IWYDHOAUDWTVEP-IDEBNGHGSA-N.

Identity
Molecular formulaC8H8O3
Molecular weight158.10 g/mol
IUPAC name2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-hydroxyacetic acid
InChIKeyIWYDHOAUDWTVEP-IDEBNGHGSA-N
SMILES[13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(C(=O)O)O

Computed by PubChem (NCBI)

Synonyms: Mandelic Acid-13C6