CAS 153489-15-7 is the registry number for Mandelic Acid-13C6. Offered by: TRC. Available pack sizes: 5mg.
2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-hydroxyacetic acid (CAS 153489-15-7) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 158.10 g/mol. IUPAC name: 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-hydroxyacetic acid. InChIKey: IWYDHOAUDWTVEP-IDEBNGHGSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 158.10 g/mol |
| IUPAC name | 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-2-hydroxyacetic acid |
| InChIKey | IWYDHOAUDWTVEP-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(C(=O)O)O |
Computed by PubChem (NCBI)