Products 70838-71-0
CAS 70838-71-0 appears in our catalog under these names: (±)-Mandelic-2,3,4,5,6-d5 Acid, >95% (HPLC), (±)-Mandelic-2,3,4,5,6-d5 Acid, 98 atom % D, min 98% Chemical Purity, Mandelic acid–2,3,4,5,6–d5, (±)-Mandelic-2,3,4,5,6-d5 acid, Mandelic acid-2,3,4,5,6-d5, 98.42%. Offered by: TRC, CDN, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 10mg, 5mg, 50mg, 500mg.
2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid (CAS 70838-71-0) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 157.18 g/mol. IUPAC name: 2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid. InChIKey: IWYDHOAUDWTVEP-RALIUCGRSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 157.18 g/mol |
| IUPAC name | 2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
| InChIKey | IWYDHOAUDWTVEP-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C(=O)O)O)[2H])[2H] |
Computed by PubChem (NCBI)